Products 33129-84-9
CAS 33129-84-9 is the registry number for 4-tert-Butylphenyl carbonochloridate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(4-tert-butylphenyl) carbonochloridate (CAS 33129-84-9) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: (4-tert-butylphenyl) carbonochloridate. InChIKey: TZHHLZDMODPXGC-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | (4-tert-butylphenyl) carbonochloridate |
| InChIKey | TZHHLZDMODPXGC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-tert-butylphenyl chloroformate, Carbonochloridic acid, 4-(1,1-dimethylethyl)phenyl ester, 4-(tert-Butyl)phenyl carbonochloridate, p-tert-Butylphenyl chloroformate, 4-tert-butylphenyl carbonochloridate, (4-tert-butylphenyl) carbonochloridate, 4-(tert-Butyl)phenyl Chloroformate, TZHHLZDMODPXGC-UHFFFAOYSA-N, 4-(t-Butyl)phenyl carbonochloridate, 4-(tert-Butyl)phenylcarbonochloridate