CAS 33143-29-2 appears in our catalog under these names: 2,2-Dimethyl-2h-chromene-6-carbonitrile, 95%, 2,2–Dimethyl–2H–chromene–6–carbonitrile, 2,2-DIMETHYL-2H-1-BENZOPYRAN-6-CARBO- &, 2,2-Dimethyl-2H-chromene-6-carbonitrile, 98%, 98%, 2,2-Dimethyl-2H-chromene-6-carbonitrile, 98%. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2,2-dimethylchromene-6-carbonitrile (CAS 33143-29-2) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 2,2-dimethylchromene-6-carbonitrile. InChIKey: YDEQIYMIVRCVAH-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2,2-dimethylchromene-6-carbonitrile |
| InChIKey | YDEQIYMIVRCVAH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2)C#N)C |
Computed by PubChem (NCBI)