CAS 331463-81-1 appears in our catalog under these names: 3-Methoxy-4-[(2-nitrobenzyl)oxy]benzaldehyde, 95%, 3-Methoxy-4-((2-nitrobenzyl)oxy)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
3-methoxy-4-[(2-nitrophenyl)methoxy]benzaldehyde (CAS 331463-81-1) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 3-methoxy-4-[(2-nitrophenyl)methoxy]benzaldehyde. InChIKey: FSRJUMIINZPJJC-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 3-methoxy-4-[(2-nitrophenyl)methoxy]benzaldehyde |
| InChIKey | FSRJUMIINZPJJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)