Products 33155-58-7
CAS 33155-58-7 appears in our catalog under these names: Tert-Butyl 2-(4-Bromophenyl)acetat, 95-<97%, Tert-Butyl 2-(4-Bromophenyl)acetat, ≥97-<99%, tert–Butyl 2–(4–Bromophenyl)acetate, tert-Butyl 2-(4-bromophenyl)acetate, tert-Butyl 2-(4-Bromophenyl)acetate 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
Tert-butyl 2-(4-bromophenyl)acetate (CAS 33155-58-7) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 2-(4-bromophenyl)acetate. InChIKey: ZMSZCAZHKBNPDV-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 2-(4-bromophenyl)acetate |
| InChIKey | ZMSZCAZHKBNPDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)