Products 331719-48-3
CAS 331719-48-3 is the registry number for 3-Amino-2-(2-fluorophenyl)quinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-amino-2-(2-fluorophenyl)quinazolin-4-one (CAS 331719-48-3) is a chemical compound with the molecular formula C14H10FN3O and a molecular weight of 255.25 g/mol. IUPAC name: 3-amino-2-(2-fluorophenyl)quinazolin-4-one. InChIKey: FVJQGAPUHMRVGJ-UHFFFAOYSA-N.
| Molecular formula | C14H10FN3O |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 3-amino-2-(2-fluorophenyl)quinazolin-4-one |
| InChIKey | FVJQGAPUHMRVGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=N2)C3=CC=CC=C3F)N |
Computed by PubChem (NCBI)