CAS 331839-81-7 is the registry number for 3-Methyl-7-(2-oxopropyl)-8-sulfanyl-1,3,7-trihydropurine-2,6-dione. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-methyl-7-(2-oxopropyl)-8-sulfanylidene-9H-purine-2,6-dione (CAS 331839-81-7) is a chemical compound with the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. IUPAC name: 3-methyl-7-(2-oxopropyl)-8-sulfanylidene-9H-purine-2,6-dione. InChIKey: XBCJUASDLWPYGE-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3S |
|---|---|
| Molecular weight | 254.27 g/mol |
| IUPAC name | 3-methyl-7-(2-oxopropyl)-8-sulfanylidene-9H-purine-2,6-dione |
| InChIKey | XBCJUASDLWPYGE-UHFFFAOYSA-N |
| SMILES | CC(=O)CN1C2=C(NC1=S)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)