CAS 882252-38-2 is the registry number for 3-{4-Oxo-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-1-yl}-1λ6-thiolane-1,1-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 882252-38-2) is a chemical compound with the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: CLIXWPZMUHETIQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3S |
|---|---|
| Molecular weight | 254.27 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | CLIXWPZMUHETIQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)