CAS 332062-10-9 appears in our catalog under these names: Fmoc-(r)-3-amino-4,4-diphenyl-butyric acid, 95%, Fmoc–(R)–3–amino–4–(4–biphenyl)butanoic acid, Benzenebutanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-γ-phenyl-, (βR)-, 98%, 98%, FMOC-(R)-3-AMINO-4,4-DIPHENYL-BUTYRIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid (CAS 332062-10-9) is a chemical compound with the molecular formula C31H27NO4 and a molecular weight of 477.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid. InChIKey: GQRZIYGFRVKFSB-MUUNZHRXSA-N.
| Molecular formula | C31H27NO4 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
| InChIKey | GQRZIYGFRVKFSB-MUUNZHRXSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)