CAS 332062-08-5 appears in our catalog under these names: Fmoc-(s)-3-amino-4,4-diphenyl-butyric acid, 95%, Fmoc–S–3–amino–4,4–diphenyl–butyric acid, (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,4-diphenylbutanoic acid, 98%, 98%, Fmoc-S-3-amino-4,4-diphenyl-butyric acid, 99.96%, FMOC-(S)-3-AMINO-4,4-DIPHENYL-BUTYRIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 1 g, 100 mg, 250 mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid (CAS 332062-08-5) is a chemical compound with the molecular formula C31H27NO4 and a molecular weight of 477.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid. InChIKey: GQRZIYGFRVKFSB-NDEPHWFRSA-N.
| Molecular formula | C31H27NO4 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
| InChIKey | GQRZIYGFRVKFSB-NDEPHWFRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)