CAS 332099-91-9 is the registry number for 2-{2-(2-(thiophen-2-yl)acetamido)-1,3-thiazol-4-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid (CAS 332099-91-9) is a chemical compound with the molecular formula C11H10N2O3S2 and a molecular weight of 282.3 g/mol. IUPAC name: 2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid. InChIKey: VNZWCTBPGFRYIR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | VNZWCTBPGFRYIR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)