Products 486400-30-0
CAS 486400-30-0 is the registry number for 2-((2-(Benzo[d]thiazol-2-ylamino)-2-oxoethyl)thio)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetic acid (CAS 486400-30-0) is a chemical compound with the molecular formula C11H10N2O3S2 and a molecular weight of 282.3 g/mol. IUPAC name: 2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetic acid. InChIKey: YWFNFDFOIRNHNV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetic acid |
| InChIKey | YWFNFDFOIRNHNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)CSCC(=O)O |
Computed by PubChem (NCBI)