Products 33240-96-9
CAS 33240-96-9 appears in our catalog under these names: 3–Nitroaniline Hydrochloride, 3-Nitroaniline Hydrochloride, >98.0%(HPLC)(T), 3-Nitroaniline hydrochloride 98%, 3-Nitroaniline hydrochloride, 98%, 98%, 3-Nitroaniline hydrochloride, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 1g.
3-nitroaniline;hydrochloride (CAS 33240-96-9) is a chemical compound with the molecular formula C6H7ClN2O2 and a molecular weight of 174.58 g/mol. IUPAC name: 3-nitroaniline;hydrochloride. InChIKey: FWUUMDDHHPVSPL-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2 |
|---|---|
| Molecular weight | 174.58 g/mol |
| IUPAC name | 3-nitroaniline;hydrochloride |
| InChIKey | FWUUMDDHHPVSPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)