CAS 3326-33-8 is the registry number for 5-Amino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 3326-33-8) is a chemical compound with the molecular formula C20H13NO5 and a molecular weight of 347.3 g/mol. IUPAC name: 7-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: QLCDVUAIWJCGRU-UHFFFAOYSA-N.
| Molecular formula | C20H13NO5 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 7-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | QLCDVUAIWJCGRU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)