CAS 51649-83-3 appears in our catalog under these names: 6-Amino-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one, 98%, Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 6-amino-3',6'-dihydroxy-, 98%, 98%, Fluoresceinamine, Isomer 2,, 6-Aminofluorescein/ 99.26% (existing batch purity), 6–Aminofluorescein (6–AF). Offered by: Fluorochem, Chemat, TRC, TargetMol, GLPBio. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10mM (in 1ml dmso), 10g.
5-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 51649-83-3) is a chemical compound with the molecular formula C20H13NO5 and a molecular weight of 347.3 g/mol. IUPAC name: 5-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: YOAWSYSKQHLFPM-UHFFFAOYSA-N.
| Molecular formula | C20H13NO5 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 5-amino-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | YOAWSYSKQHLFPM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Computed by PubChem (NCBI)