CAS 33265-60-0 appears in our catalog under these names: 1-(2-Nitrophenyl)pyrrole, 95%, 1–(2–Nitrophenyl)–1H–pyrrole, 1-(2-Nitrophenyl)pyrrole, 1H-Pyrrole, 1-(2-nitrophenyl)-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg.
1-(2-nitrophenyl)pyrrole (CAS 33265-60-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 1-(2-nitrophenyl)pyrrole. InChIKey: UQNRTIQURQZGKL-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1-(2-nitrophenyl)pyrrole |
| InChIKey | UQNRTIQURQZGKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)