CAS 332939-32-9 appears in our catalog under these names: WAY-322243, 98%, WAY-322243/ 99.47% (existing batch purity), CLK1–IN–4, CLK1-IN-4, 99.75%, WAY-322243, ≥98%. Offered by: AmBeed, TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
N-[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]butanamide (CAS 332939-32-9) is a chemical compound with the molecular formula C18H18N2O2S and a molecular weight of 326.4 g/mol. IUPAC name: N-[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]butanamide. InChIKey: HQMZBXRQASJEMD-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O2S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | N-[(8-hydroxyquinolin-7-yl)-thiophen-2-ylmethyl]butanamide |
| InChIKey | HQMZBXRQASJEMD-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC(C1=C(C2=C(C=CC=N2)C=C1)O)C3=CC=CS3 |
Computed by PubChem (NCBI)