CAS 894351-84-9 is the registry number for (1E)-N-Methyl-2-(1-(phenylmethyl)-1H-indol-5-yl)ethenesulfonamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
(E)-2-(1-benzylindol-5-yl)-N-methylethenesulfonamide (CAS 894351-84-9) is a chemical compound with the molecular formula C18H18N2O2S and a molecular weight of 326.4 g/mol. IUPAC name: (E)-2-(1-benzylindol-5-yl)-N-methylethenesulfonamide. InChIKey: CGQXKKYAWNNJJX-ZRDIBKRKSA-N.
| Molecular formula | C18H18N2O2S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (E)-2-(1-benzylindol-5-yl)-N-methylethenesulfonamide |
| InChIKey | CGQXKKYAWNNJJX-ZRDIBKRKSA-N |
| SMILES | CNS(=O)(=O)/C=C/C1=CC2=C(C=C1)N(C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)