Products 332950-12-6
CAS 332950-12-6 is the registry number for ISR activator 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 2-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate (CAS 332950-12-6) is a chemical compound with the molecular formula C23H21N3O3S2 and a molecular weight of 451.6 g/mol. IUPAC name: ethyl 2-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate. InChIKey: BPVWCTZLAKMQDH-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O3S2 |
|---|---|
| Molecular weight | 451.6 g/mol |
| IUPAC name | ethyl 2-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
| InChIKey | BPVWCTZLAKMQDH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC=CC=C2)NC(=O)C3=C(C4=C(S3)N=C(C=C4C)C)N |
Computed by PubChem (NCBI)