CAS 879730-44-6 is the registry number for EGFR/HER2/CDK9-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(2-benzylsulfanyl-4-oxoquinazolin-3-yl)ethyl]benzenesulfonamide (CAS 879730-44-6) is a chemical compound with the molecular formula C23H21N3O3S2 and a molecular weight of 451.6 g/mol. IUPAC name: 4-[2-(2-benzylsulfanyl-4-oxoquinazolin-3-yl)ethyl]benzenesulfonamide. InChIKey: BBMUYWDZIIQJMA-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O3S2 |
|---|---|
| Molecular weight | 451.6 g/mol |
| IUPAC name | 4-[2-(2-benzylsulfanyl-4-oxoquinazolin-3-yl)ethyl]benzenesulfonamide |
| InChIKey | BBMUYWDZIIQJMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC3=CC=CC=C3C(=O)N2CCC4=CC=C(C=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)