CAS 33334-94-0 is the registry number for N-Benzyl-3-nitroaniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
N-benzyl-3-nitroaniline (CAS 33334-94-0) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: N-benzyl-3-nitroaniline. InChIKey: OVZNWAWUJPSLHM-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | N-benzyl-3-nitroaniline |
| InChIKey | OVZNWAWUJPSLHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)