CAS 333353-44-9 appears in our catalog under these names: Nbd-556, 95%, NBD-556/ 99.76% (existing batch purity), NBD–556, NBD-556, >98.0%(HPLC), N1-(4-Chlorophenyl)-N2-(2,2,6,6-tetramethyl-4-piperidinyl)-ethanediamide. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Biosynth. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso), 0,5g.
N'-(4-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (CAS 333353-44-9) is a chemical compound with the molecular formula C17H24ClN3O2 and a molecular weight of 337.8 g/mol. IUPAC name: N'-(4-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide. InChIKey: ZKXLQCIOURANAD-UHFFFAOYSA-N.
| Molecular formula | C17H24ClN3O2 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | N'-(4-chlorophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| InChIKey | ZKXLQCIOURANAD-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)NC(=O)C(=O)NC2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)