Products 99390-76-8
CAS 99390-76-8 appears in our catalog under these names: BMY-27709/ 98%, BMY-27709. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
N-[(2S,6R,9aR)-6-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-4-amino-5-chloro-2-hydroxybenzamide (CAS 99390-76-8) is a chemical compound with the molecular formula C17H24ClN3O2 and a molecular weight of 337.8 g/mol. IUPAC name: N-[(2S,6R,9aR)-6-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-4-amino-5-chloro-2-hydroxybenzamide. InChIKey: SQQXDSFKORQHET-GRYCIOLGSA-N.
| Molecular formula | C17H24ClN3O2 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | N-[(2S,6R,9aR)-6-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]-4-amino-5-chloro-2-hydroxybenzamide |
| InChIKey | SQQXDSFKORQHET-GRYCIOLGSA-N |
| SMILES | C[C@@H]1CCC[C@H]2N1CC[C@@H](C2)NC(=O)C3=CC(=C(C=C3O)N)Cl |
Computed by PubChem (NCBI)