Products 33373-19-2

CAS 33373-19-2 is the registry number for Ethyl 2-thioxobenzo[d][1,3]dioxole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2-sulfanylidene-1,3-benzodioxole-5-carboxylate (CAS 33373-19-2) is a chemical compound with the molecular formula C10H8O4S and a molecular weight of 224.23 g/mol. IUPAC name: ethyl 2-sulfanylidene-1,3-benzodioxole-5-carboxylate. InChIKey: QDQTUYCZUGPKGH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O4S
Molecular weight224.23 g/mol
IUPAC nameethyl 2-sulfanylidene-1,3-benzodioxole-5-carboxylate
InChIKeyQDQTUYCZUGPKGH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=C1)OC(=S)O2

Computed by PubChem (NCBI)