CAS 33373-19-2 is the registry number for Ethyl 2-thioxobenzo[d][1,3]dioxole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-sulfanylidene-1,3-benzodioxole-5-carboxylate (CAS 33373-19-2) is a chemical compound with the molecular formula C10H8O4S and a molecular weight of 224.23 g/mol. IUPAC name: ethyl 2-sulfanylidene-1,3-benzodioxole-5-carboxylate. InChIKey: QDQTUYCZUGPKGH-UHFFFAOYSA-N.
| Molecular formula | C10H8O4S |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | ethyl 2-sulfanylidene-1,3-benzodioxole-5-carboxylate |
| InChIKey | QDQTUYCZUGPKGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)OC(=S)O2 |
Computed by PubChem (NCBI)