CAS 3771-14-0 appears in our catalog under these names: 4–Hydroxynaphthalene–2–sulfonic acid, 4-Hydroxynaphthalene-2-sulfonic acid, 97%, 97%, 4-HYDROXYNAPHTHALENE-2-SULFONIC ACID, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-hydroxynaphthalene-2-sulfonic acid (CAS 3771-14-0) is a chemical compound with the molecular formula C10H8O4S and a molecular weight of 224.23 g/mol. IUPAC name: 4-hydroxynaphthalene-2-sulfonic acid. InChIKey: HKWPUUYEGGDLJF-UHFFFAOYSA-N.
| Molecular formula | C10H8O4S |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 4-hydroxynaphthalene-2-sulfonic acid |
| InChIKey | HKWPUUYEGGDLJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2O)S(=O)(=O)O |
Computed by PubChem (NCBI)