CAS 333773-08-3 is the registry number for 3-(5-(2-Bromophenyl)-1,3,4-oxadiazol-2-yl)-6-methoxy-2H-chromen-2-one, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg.
3-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]-6-methoxychromen-2-one (CAS 333773-08-3) is a chemical compound with the molecular formula C18H11BrN2O4 and a molecular weight of 399.2 g/mol. IUPAC name: 3-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]-6-methoxychromen-2-one. InChIKey: WOAOONPOPPXSIQ-UHFFFAOYSA-N.
| Molecular formula | C18H11BrN2O4 |
|---|---|
| Molecular weight | 399.2 g/mol |
| IUPAC name | 3-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]-6-methoxychromen-2-one |
| InChIKey | WOAOONPOPPXSIQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=O)C(=C2)C3=NN=C(O3)C4=CC=CC=C4Br |
Computed by PubChem (NCBI)