CAS 784169-89-7 is the registry number for 7-((5-(2-Bromophenyl)-1,3,4-oxadiazol-2-yl)methoxy)-2H-chromen-2-one. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one (CAS 784169-89-7) is a chemical compound with the molecular formula C18H11BrN2O4 and a molecular weight of 399.2 g/mol. IUPAC name: 7-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one. InChIKey: XKTDCSNRKCIWRV-UHFFFAOYSA-N.
| Molecular formula | C18H11BrN2O4 |
|---|---|
| Molecular weight | 399.2 g/mol |
| IUPAC name | 7-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]chromen-2-one |
| InChIKey | XKTDCSNRKCIWRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(O2)COC3=CC4=C(C=C3)C=CC(=O)O4)Br |
Computed by PubChem (NCBI)