CAS 334473-41-5 appears in our catalog under these names: Dihydro Uracil-d4, >95% (HPLC), 5,6-Dihydrouracil-5,5,6,6-d4, 99 atom % D, min 98% Chemical Purity, Dihydrouracil-d4, 99.97%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,01g, 0,005g, 1 mg, 5 mg.
5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione (CAS 334473-41-5) is a chemical compound with the molecular formula C4H6N2O2 and a molecular weight of 118.13 g/mol. IUPAC name: 5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione. InChIKey: OIVLITBTBDPEFK-LNLMKGTHSA-N.
| Molecular formula | C4H6N2O2 |
|---|---|
| Molecular weight | 118.13 g/mol |
| IUPAC name | 5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione |
| InChIKey | OIVLITBTBDPEFK-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(=O)NC(=O)NC1([2H])[2H])[2H] |
Computed by PubChem (NCBI)