Products 360769-22-8
CAS 360769-22-8 is the registry number for Dihydrouracil-13C4,15N2. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(2,4,5,6-13C4,1,3-15N2)1,3-diazinane-2,4-dione (CAS 360769-22-8) is a chemical compound with the molecular formula C4H6N2O2 and a molecular weight of 120.060 g/mol. IUPAC name: (2,4,5,6-13C4,1,3-15N2)1,3-diazinane-2,4-dione. InChIKey: OIVLITBTBDPEFK-IDEBNGHGSA-N.
| Molecular formula | C4H6N2O2 |
|---|---|
| Molecular weight | 120.060 g/mol |
| IUPAC name | (2,4,5,6-13C4,1,3-15N2)1,3-diazinane-2,4-dione |
| InChIKey | OIVLITBTBDPEFK-IDEBNGHGSA-N |
| SMILES | [13CH2]1[13CH2][15NH][13C](=O)[15NH][13C]1=O |
Computed by PubChem (NCBI)