CAS 3348-03-6 appears in our catalog under these names: 6–CFDA, 6-Carboxyfluorescein diacetate, 6-CFDA, 98.09%, 6-Carboxyfluorescein diacetate, 95%, 6-CFDA 95% HPLC. Offered by: GLPBio, Chemat, Sigma-Aldrich, MedChemExpress, Combi-blocks. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 50mg, 1g, 25mg, 100 mg, 5 mg.
3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid (CAS 3348-03-6) is a chemical compound with the molecular formula C25H16O9 and a molecular weight of 460.4 g/mol. IUPAC name: 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid. InChIKey: QMOGCCYGOPYYNT-UHFFFAOYSA-N.
| Molecular formula | C25H16O9 |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| InChIKey | QMOGCCYGOPYYNT-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=C(C=CC(=C5)C(=O)O)C(=O)O3 |
Computed by PubChem (NCBI)