CAS 79955-27-4 appears in our catalog under these names: 5-Carboxyfluorescein diacetate, 95%, 5-CFDA/ 98.39% (existing batch purity), 5-Carboxyfluorescein diacetate , 93.00%, 5-Carboxyfluorescein diacetate, 5-Carboxyfluorescein Diacetate, >93.0%(HPLC)(T). Offered by: Combi-blocks, TargetMol, Chemat, Biosynth, TCI. Available pack sizes: 250mg, 1g, 100mg, 25mg, 50mg, 500mg, 200mg, 1000mg.
3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (CAS 79955-27-4) is a chemical compound with the molecular formula C25H16O9 and a molecular weight of 460.4 g/mol. IUPAC name: 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid. InChIKey: WPUZGNPQMIWOHE-UHFFFAOYSA-N.
| Molecular formula | C25H16O9 |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| InChIKey | WPUZGNPQMIWOHE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)O)C(=O)O3)C5=C(O2)C=C(C=C5)OC(=O)C |
Computed by PubChem (NCBI)