CAS 3349-64-2 appears in our catalog under these names: 1,2,3,4-Tetrahydronaphthalen-1-one oxime, 98%, 3,4–Dihydro–1(2H)–naphthalenone oxime, 3,4-Dihydronaphthalen-1(2H)-one Oxime, >95.0%(GC), 3,4-Dihydronaphthalen-1(2H)-one oxime, 3,4-Dihydro-2H-naphthalen-1-one oxime, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg, 50mg.
(NZ)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (CAS 3349-64-2) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: (NZ)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine. InChIKey: YFDVQUUMKXZPLK-KHPPLWFESA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | (NZ)-N-(3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| InChIKey | YFDVQUUMKXZPLK-KHPPLWFESA-N |
| SMILES | C1CC2=CC=CC=C2/C(=N\O)/C1 |
Computed by PubChem (NCBI)