CAS 335-58-0 is the registry number for Perfluoroheptyl Iodide, >95% (GC). Offered by: TRC. Available pack sizes: 10g, 1g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-iodoheptane (CAS 335-58-0) is a chemical compound with the molecular formula C7F15I and a molecular weight of 495.95 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-iodoheptane. InChIKey: AHUMDLIBMIYQMU-UHFFFAOYSA-N.
| Molecular formula | C7F15I |
|---|---|
| Molecular weight | 495.95 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-iodoheptane |
| InChIKey | AHUMDLIBMIYQMU-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)I)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)