CAS 3486-08-6 is the registry number for Perfluoroisoheptyl iodide, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-6-iodo-2-(trifluoromethyl)hexane (CAS 3486-08-6) is a chemical compound with the molecular formula C7F15I and a molecular weight of 495.95 g/mol. IUPAC name: 1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-6-iodo-2-(trifluoromethyl)hexane. InChIKey: OUFXTVSYOAPUKM-UHFFFAOYSA-N.
| Molecular formula | C7F15I |
|---|---|
| Molecular weight | 495.95 g/mol |
| IUPAC name | 1,1,1,2,3,3,4,4,5,5,6,6-dodecafluoro-6-iodo-2-(trifluoromethyl)hexane |
| InChIKey | OUFXTVSYOAPUKM-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)