CAS 335013-04-2 is the registry number for Ethyl 4-chloro-3-methylbenzoate, 98%. Offered by: AmBeed. Available pack sizes: 10g.
Ethyl 4-chloro-3-methylbenzoate (CAS 335013-04-2) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: ethyl 4-chloro-3-methylbenzoate. InChIKey: IVTUZGLCHFFWTG-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | ethyl 4-chloro-3-methylbenzoate |
| InChIKey | IVTUZGLCHFFWTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Cl)C |
Computed by PubChem (NCBI)