CAS 33607-57-7 is the registry number for Biotin Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
(3aR,6aS)-1,3-dibenzyl-6,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,4-dione (CAS 33607-57-7) is a chemical compound with the molecular formula C19H18N2O2S and a molecular weight of 338.4 g/mol. IUPAC name: (3aR,6aS)-1,3-dibenzyl-6,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,4-dione. InChIKey: XJZIDYQGGLZUIO-IAGOWNOFSA-N.
| Molecular formula | C19H18N2O2S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (3aR,6aS)-1,3-dibenzyl-6,6a-dihydro-3aH-thieno[3,4-d]imidazole-2,4-dione |
| InChIKey | XJZIDYQGGLZUIO-IAGOWNOFSA-N |
| SMILES | C1[C@@H]2[C@H](C(=O)S1)N(C(=O)N2CC3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)