CAS 880090-88-0 appears in our catalog under these names: Ethyl 4-(methyl(2-phenylthiazol-4-yl)amino)benzoate, 95%, Neuropathiazol/ 99.49% (existing batch purity), Neuropathiazol, Neuropathiazol 99%, Neuropathiazol, 98.18%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
Ethyl 4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]benzoate (CAS 880090-88-0) is a chemical compound with the molecular formula C19H18N2O2S and a molecular weight of 338.4 g/mol. IUPAC name: ethyl 4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]benzoate. InChIKey: MGKYEWWFHSESJN-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | ethyl 4-[methyl-(2-phenyl-1,3-thiazol-4-yl)amino]benzoate |
| InChIKey | MGKYEWWFHSESJN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N(C)C2=CSC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)