CAS 33664-93-6 is the registry number for 5,5-Dimethyl-4-phenyloxazolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one (CAS 33664-93-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one. InChIKey: HSQRCAULDOQKPF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
| InChIKey | HSQRCAULDOQKPF-UHFFFAOYSA-N |
| SMILES | CC1(C(NC(=O)O1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)