Products 336881-24-4
CAS 336881-24-4 is the registry number for methyl 5-cyclopropyl-1-(5-quinolyl)pyrazole-4-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 5-cyclopropyl-1-quinolin-5-ylpyrazole-4-carboxylate (CAS 336881-24-4) is a chemical compound with the molecular formula C17H15N3O2 and a molecular weight of 293.32 g/mol. IUPAC name: methyl 5-cyclopropyl-1-quinolin-5-ylpyrazole-4-carboxylate. InChIKey: UOWBHNVPNLWAEH-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O2 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | methyl 5-cyclopropyl-1-quinolin-5-ylpyrazole-4-carboxylate |
| InChIKey | UOWBHNVPNLWAEH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=C1)C2=CC=CC3=C2C=CC=N3)C4CC4 |
Computed by PubChem (NCBI)