CAS 33693-84-4 appears in our catalog under these names: tert-Butyl hydrogen phthalate, 97%, 2-(tert-Butoxycarbonyl)benzoic acid, 95%, tert-Butyl hydrogen phthalate, 97% , tert-Butyl hydrogen phthalate, 2-(tert-Butoxycarbonyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 1g, 25g, 5g.
2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid (CAS 33693-84-4) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid. InChIKey: PBUQZKXKYSAJDO-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid |
| InChIKey | PBUQZKXKYSAJDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)