CAS 337464-19-4 is the registry number for 6,7-Dibromo-2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6,7-dibromo-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 337464-19-4) is a chemical compound with the molecular formula C7H4Br2N2O2 and a molecular weight of 307.93 g/mol. IUPAC name: 6,7-dibromo-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: VEYYAUZQYLCUFY-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2O2 |
|---|---|
| Molecular weight | 307.93 g/mol |
| IUPAC name | 6,7-dibromo-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | VEYYAUZQYLCUFY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=NC(=C(C=C2O1)Br)Br |
Computed by PubChem (NCBI)