CAS 1313441-46-1 is the registry number for 6,7-Dibromo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dibromo-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 1313441-46-1) is a chemical compound with the molecular formula C7H4Br2N2O2 and a molecular weight of 307.93 g/mol. IUPAC name: 6,7-dibromo-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: WPIHFZOKNDTJNI-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2O2 |
|---|---|
| Molecular weight | 307.93 g/mol |
| IUPAC name | 6,7-dibromo-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | WPIHFZOKNDTJNI-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(N=C2O1)Br)Br |
Computed by PubChem (NCBI)