CAS 1305325-17-0 appears in our catalog under these names: 6,8-Dibromo-2h-pyrido[3,2-b][1,4]oxazin-3(4h)-one, 95%, 6,8-DIbromo-2h-pyrido(3,2-b)(1,4)oxazin-3(4h)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
6,8-dibromo-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 1305325-17-0) is a chemical compound with the molecular formula C7H4Br2N2O2 and a molecular weight of 307.93 g/mol. IUPAC name: 6,8-dibromo-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: JHZOISDXZFHKJP-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2O2 |
|---|---|
| Molecular weight | 307.93 g/mol |
| IUPAC name | 6,8-dibromo-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | JHZOISDXZFHKJP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC(=N2)Br)Br |
Computed by PubChem (NCBI)