CAS 33757-45-8 is the registry number for 2,2,2-Trichloro-N-(quinolin-8-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trichloro-N-quinolin-8-ylacetamide (CAS 33757-45-8) is a chemical compound with the molecular formula C11H7Cl3N2O and a molecular weight of 289.5 g/mol. IUPAC name: 2,2,2-trichloro-N-quinolin-8-ylacetamide. InChIKey: FLIMXHHCNLPSEG-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl3N2O |
|---|---|
| Molecular weight | 289.5 g/mol |
| IUPAC name | 2,2,2-trichloro-N-quinolin-8-ylacetamide |
| InChIKey | FLIMXHHCNLPSEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NC(=O)C(Cl)(Cl)Cl)N=CC=C2 |
Computed by PubChem (NCBI)