CAS 937630-10-9 appears in our catalog under these names: 4,5-Dichloro-2-(3-chloro-4-methylphenyl)pyridazin-3(2h)-one, 95%, 4,5-Dichloro-2-(3-chloro-4-methylphenyl)-2,3-dihydropyridazin-3-one, 95%, 4,5-Dichloro-2-(3-chloro-4-methylphenyl)pyridazin-3(2H)-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4,5-dichloro-2-(3-chloro-4-methylphenyl)pyridazin-3-one (CAS 937630-10-9) is a chemical compound with the molecular formula C11H7Cl3N2O and a molecular weight of 289.5 g/mol. IUPAC name: 4,5-dichloro-2-(3-chloro-4-methylphenyl)pyridazin-3-one. InChIKey: KWPFAIJIWYLDLQ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl3N2O |
|---|---|
| Molecular weight | 289.5 g/mol |
| IUPAC name | 4,5-dichloro-2-(3-chloro-4-methylphenyl)pyridazin-3-one |
| InChIKey | KWPFAIJIWYLDLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C(=C(C=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)