CAS 3380-30-1 appears in our catalog under these names: Diclosan, Diclosan, >95% (HPLC), Diclosan-d4, Diclosan 97%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 10mg, 0,5g, 5g, 250mg, 1g, 1x10mg.
5-chloro-2-(4-chlorophenoxy)phenol (CAS 3380-30-1) is a chemical compound with the molecular formula C12H8Cl2O2 and a molecular weight of 255.09 g/mol. IUPAC name: 5-chloro-2-(4-chlorophenoxy)phenol. InChIKey: BYNQFCJOHGOKSS-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2 |
|---|---|
| Molecular weight | 255.09 g/mol |
| IUPAC name | 5-chloro-2-(4-chlorophenoxy)phenol |
| InChIKey | BYNQFCJOHGOKSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)Cl)O)Cl |
Computed by PubChem (NCBI)