CAS 35288-49-4 is the registry number for 1,4-Phenylenediacryloyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-[4-[(E)-3-chloro-3-oxoprop-1-enyl]phenyl]prop-2-enoyl chloride (CAS 35288-49-4) is a chemical compound with the molecular formula C12H8Cl2O2 and a molecular weight of 255.09 g/mol. IUPAC name: (E)-3-[4-[(E)-3-chloro-3-oxoprop-1-enyl]phenyl]prop-2-enoyl chloride. InChIKey: WQZLRZFBCIUDFL-KQQUZDAGSA-N.
| Molecular formula | C12H8Cl2O2 |
|---|---|
| Molecular weight | 255.09 g/mol |
| IUPAC name | (E)-3-[4-[(E)-3-chloro-3-oxoprop-1-enyl]phenyl]prop-2-enoyl chloride |
| InChIKey | WQZLRZFBCIUDFL-KQQUZDAGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)Cl)/C=C/C(=O)Cl |
Computed by PubChem (NCBI)