CAS 3382-43-2 is the registry number for 1,2,3,4-Tetrahydro-7-methoxycarbazole. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
7-methoxy-2,3,4,9-tetrahydro-1H-carbazole (CAS 3382-43-2) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 7-methoxy-2,3,4,9-tetrahydro-1H-carbazole. InChIKey: LAOWVRRXCCBHEP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 7-methoxy-2,3,4,9-tetrahydro-1H-carbazole |
| InChIKey | LAOWVRRXCCBHEP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(N2)CCCC3 |
Computed by PubChem (NCBI)