Products 3382-84-1
CAS 3382-84-1 appears in our catalog under these names: Tetrahydrorhombifoline, Tetrahydrorhombifoline, 97.0%, Tetrahydrorhombifoline, 97.5%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg, 5 mg, 5mg.
(1S,2R,9R)-11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (CAS 3382-84-1) is a chemical compound with the molecular formula C15H24N2O and a molecular weight of 248.36 g/mol. IUPAC name: (1S,2R,9R)-11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one. InChIKey: OKTIETCHYDTVGN-HZSPNIEDSA-N.
| Molecular formula | C15H24N2O |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | (1S,2R,9R)-11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| InChIKey | OKTIETCHYDTVGN-HZSPNIEDSA-N |
| SMILES | C=CCCN1C[C@H]2C[C@@H](C1)[C@H]3CCCC(=O)N3C2 |
Computed by PubChem (NCBI)