Products 33831-56-0

CAS 33831-56-0 is the registry number for Ethyl 4-hydroxy-2,6-dimethylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylate (CAS 33831-56-0) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: ethyl 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylate. InChIKey: DLHHQCQHFXZHRR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC nameethyl 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylate
InChIKeyDLHHQCQHFXZHRR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=CC1=O)C)C

Computed by PubChem (NCBI)