Products 338410-87-0
CAS 338410-87-0 is the registry number for N-(1-(1H-1,3-Benzodiazol-2-yl)ethyl)-2,4-dichlorobenzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[1-(1H-benzimidazol-2-yl)ethyl]-2,4-dichlorobenzamide (CAS 338410-87-0) is a chemical compound with the molecular formula C16H13Cl2N3O and a molecular weight of 334.2 g/mol. IUPAC name: N-[1-(1H-benzimidazol-2-yl)ethyl]-2,4-dichlorobenzamide. InChIKey: GLOWGQDIXUPDIH-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N3O |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2,4-dichlorobenzamide |
| InChIKey | GLOWGQDIXUPDIH-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=CC=CC=C2N1)NC(=O)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)